C12H17FN5O11P3 — CID 139293723
[(1S,2R,3R,4S,5R)-3-(6-aminopurin-9-yl)-2-fluoro-1-hydroxy-4-methyl-6-bicyclo[3.1.0]hexanyl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate (PubChem CID 139293723) has the molecular formula C12H17FN5O11P3 and a molecular weight of 519.21 g/mol. Its IUPAC name is [(1S,2R,3R,4S,5R)-3-(6-aminopurin-9-yl)-2-fluoro-1-hydroxy-4-methyl-6-bicyclo[3.1.0]hexanyl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate.
| Compound Name | [(1S,2R,3R,4S,5R)-3-(6-aminopurin-9-yl)-2-fluoro-1-hydroxy-4-methyl-6-bicyclo[3.1.0]hexanyl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 139293723 |
| Molecular Formula | C12H17FN5O11P3 |
| Molecular Weight | 519.21 g/mol |
| Exact Mass | 519.01 |
| IUPAC Name | [(1S,2R,3R,4S,5R)-3-(6-aminopurin-9-yl)-2-fluoro-1-hydroxy-4-methyl-6-bicyclo[3.1.0]hexanyl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
| SMILES | C[C@@H]1[C@@H](n2cnc3c(N)ncnc32)[C@@H](F)[C@@]2(O)C(OP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H]12 |
| InChI | InChI=1S/C12H17FN5O11P3/c1-4-5-9(27-31(23,24)29-32(25,26)28-30(20,21)22)12(5,19)8(13)7(4)18-3-17-6-10(14)15-2-16-11(6)18/h2-5,7-9,19H,1H3,(H,23,24)(H,25,26)(H2,14,15,16)(H2,20,21,22)/t4-,5+,7+,8+,9?,12+/m0/s1 |
| InChIKey | LNJGCLIVKJMVQX-SINHOVFNSA-N |
| XLogP | 0.01 |
| TPSA | 249.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.21 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|