C34H61NO8 — CID 126725766
5-O-butyl 1-O-[4-ethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl] 3-O-(2-methylpropyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 126725766) has the molecular formula C34H61NO8 and a molecular weight of 611.86 g/mol. Its IUPAC name is 5-O-butyl 1-O-[4-ethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl] 3-O-(2-methylpropyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 5-O-butyl 1-O-[4-ethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl] 3-O-(2-methylpropyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 126725766 |
| Molecular Formula | C34H61NO8 |
| Molecular Weight | 611.86 g/mol |
| Exact Mass | 611.44 |
| IUPAC Name | 5-O-butyl 1-O-[4-ethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl] 3-O-(2-methylpropyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCCCOC(=O)C(C)(CC)CC(C)(CC(C)(C)C(=O)OC1(CC)CCN(C(=O)OC(C)(C)C)CC1)C(=O)OCC(C)C |
| InChI | InChI=1S/C34H61NO8/c1-13-16-21-40-27(37)32(11,14-2)24-33(12,28(38)41-22-25(4)5)23-31(9,10)26(36)42-34(15-3)17-19-35(20-18-34)29(39)43-30(6,7)8/h25H,13-24H2,1-12H3 |
| InChIKey | MFESBUPVMRKHCK-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.86 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|