C25H28N6O2 — CID 126727555
2-(3-tert-butyl-2H-pyrrol-5-yl)-1-[3-(6-methoxy-7-methylquinazolin-4-yl)oxyphenyl]guanidine (PubChem CID 126727555) has the molecular formula C25H28N6O2 and a molecular weight of 444.54 g/mol. Its IUPAC name is 2-(3-tert-butyl-2H-pyrrol-5-yl)-1-[3-(6-methoxy-7-methylquinazolin-4-yl)oxyphenyl]guanidine.
| Compound Name | 2-(3-tert-butyl-2H-pyrrol-5-yl)-1-[3-(6-methoxy-7-methylquinazolin-4-yl)oxyphenyl]guanidine |
|---|---|
| PubChem CID | 126727555 |
| Molecular Formula | C25H28N6O2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 2-(3-tert-butyl-2H-pyrrol-5-yl)-1-[3-(6-methoxy-7-methylquinazolin-4-yl)oxyphenyl]guanidine |
| SMILES | COc1cc2c(Oc3cccc(N/C(N)=N/C4=NCC(C(C)(C)C)=C4)c3)ncnc2cc1C |
| InChI | InChI=1S/C25H28N6O2/c1-15-9-20-19(12-21(15)32-5)23(29-14-28-20)33-18-8-6-7-17(11-18)30-24(26)31-22-10-16(13-27-22)25(2,3)4/h6-12,14H,13H2,1-5H3,(H3,26,27,30,31) |
| InChIKey | FVCVHHUUTOPZKH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 107.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|