C24H19F3N4O4S — CID 172817866
1-[3-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-[4-(trifluoromethoxy)phenyl]thiourea (PubChem CID 172817866) has the molecular formula C24H19F3N4O4S and a molecular weight of 516.50 g/mol. Its IUPAC name is 1-[3-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-[4-(trifluoromethoxy)phenyl]thiourea.
| Compound Name | 1-[3-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-[4-(trifluoromethoxy)phenyl]thiourea |
|---|---|
| PubChem CID | 172817866 |
| Molecular Formula | C24H19F3N4O4S |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | 1-[3-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-[4-(trifluoromethoxy)phenyl]thiourea |
| SMILES | COc1cc2ncnc(Oc3cccc(NC(=S)Nc4ccc(OC(F)(F)F)cc4)c3)c2cc1OC |
| InChI | InChI=1S/C24H19F3N4O4S/c1-32-20-11-18-19(12-21(20)33-2)28-13-29-22(18)34-17-5-3-4-15(10-17)31-23(36)30-14-6-8-16(9-7-14)35-24(25,26)27/h3-13H,1-2H3,(H2,30,31,36) |
| InChIKey | TUWHEESUBBJPSF-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 86.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|