C14H11NO3S — CID 126728284
3-hydroxy-4-[2-(2-methyl-4-pyridinyl)-2,3-dihydrothiophen-5-yl]cyclobut-3-ene-1,2-dione (PubChem CID 126728284) has the molecular formula C14H11NO3S and a molecular weight of 273.31 g/mol. Its IUPAC name is 3-hydroxy-4-[2-(2-methyl-4-pyridinyl)-2,3-dihydrothiophen-5-yl]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-hydroxy-4-[2-(2-methyl-4-pyridinyl)-2,3-dihydrothiophen-5-yl]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 126728284 |
| Molecular Formula | C14H11NO3S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 3-hydroxy-4-[2-(2-methyl-4-pyridinyl)-2,3-dihydrothiophen-5-yl]cyclobut-3-ene-1,2-dione |
| SMILES | Cc1cc(C2CC=C(c3c(O)c(=O)c3=O)S2)ccn1 |
| InChI | InChI=1S/C14H11NO3S/c1-7-6-8(4-5-15-7)9-2-3-10(19-9)11-12(16)14(18)13(11)17/h3-6,9,16H,2H2,1H3 |
| InChIKey | JMNUIPAZYLRBJZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|