C44H34N2O2 — CID 126729284
N'-[(Z)-3-[4-(7,7-dimethyl-[1]benzofuro[3,2-c]xanthen-10-yl)phenyl]-1-phenylprop-1-enyl]-N-methylidenebenzenecarboximidamide (PubChem CID 126729284) has the molecular formula C44H34N2O2 and a molecular weight of 622.77 g/mol. Its IUPAC name is N'-[(Z)-3-[4-(7,7-dimethyl-[1]benzofuro[3,2-c]xanthen-10-yl)phenyl]-1-phenylprop-1-enyl]-N-methylidenebenzenecarboximidamide.
| Compound Name | N'-[(Z)-3-[4-(7,7-dimethyl-[1]benzofuro[3,2-c]xanthen-10-yl)phenyl]-1-phenylprop-1-enyl]-N-methylidenebenzenecarboximidamide |
|---|---|
| PubChem CID | 126729284 |
| Molecular Formula | C44H34N2O2 |
| Molecular Weight | 622.77 g/mol |
| Exact Mass | 622.26 |
| IUPAC Name | N'-[(Z)-3-[4-(7,7-dimethyl-[1]benzofuro[3,2-c]xanthen-10-yl)phenyl]-1-phenylprop-1-enyl]-N-methylidenebenzenecarboximidamide |
| SMILES | C=N/C(=N\C(=C/Cc1ccc(-c2ccc3c(c2)Oc2c(ccc4c2oc2ccccc24)C3(C)C)cc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H34N2O2/c1-44(2)36-25-23-33(28-40(36)48-42-37(44)26-24-35-34-16-10-11-17-39(34)47-41(35)42)30-21-18-29(19-22-30)20-27-38(31-12-6-4-7-13-31)46-43(45-3)32-14-8-5-9-15-32/h4-19,21-28H,3,20H2,1-2H3/b38-27-,46-43- |
| InChIKey | YVXWNNUTNJITQB-LICIKZFUSA-N |
| XLogP | 11.42 |
| TPSA | 47.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.77 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|