C39H33N3O2 — CID 144964159
7,7-dimethyl-N'-[C-(2-methylphenyl)-N-[(E)-1-phenylprop-1-enyl]carbonimidoyl]-[1]benzofuro[3,2-c]xanthene-10-carboximidamide (PubChem CID 144964159) has the molecular formula C39H33N3O2 and a molecular weight of 575.71 g/mol. Its IUPAC name is 7,7-dimethyl-N'-[C-(2-methylphenyl)-N-[(E)-1-phenylprop-1-enyl]carbonimidoyl]-[1]benzofuro[3,2-c]xanthene-10-carboximidamide.
| Compound Name | 7,7-dimethyl-N'-[C-(2-methylphenyl)-N-[(E)-1-phenylprop-1-enyl]carbonimidoyl]-[1]benzofuro[3,2-c]xanthene-10-carboximidamide |
|---|---|
| PubChem CID | 144964159 |
| Molecular Formula | C39H33N3O2 |
| Molecular Weight | 575.71 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | 7,7-dimethyl-N'-[C-(2-methylphenyl)-N-[(E)-1-phenylprop-1-enyl]carbonimidoyl]-[1]benzofuro[3,2-c]xanthene-10-carboximidamide |
| SMILES | C/C=C(/N=C(/N=C(\N)c1ccc2c(c1)Oc1c(ccc3c1oc1ccccc13)C2(C)C)c1ccccc1C)c1ccccc1 |
| InChI | InChI=1S/C39H33N3O2/c1-5-32(25-14-7-6-8-15-25)41-38(27-16-10-9-13-24(27)2)42-37(40)26-19-21-30-34(23-26)44-36-31(39(30,3)4)22-20-29-28-17-11-12-18-33(28)43-35(29)36/h5-23H,1-4H3,(H2,40,41,42)/b32-5+ |
| InChIKey | JAJHXFZEPFDHTK-HXMLLKBMSA-N |
| XLogP | 9.54 |
| TPSA | 73.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.71 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|