C20H23F2N5O3S2 — CID 126731741
N-[2-[(8aS)-2-amino-6,6-dimethyl-4,4a,5,8-tetrahydropyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-5-(difluoromethoxy)-3-methylpyridine-2-carboxamide (PubChem CID 126731741) has the molecular formula C20H23F2N5O3S2 and a molecular weight of 483.57 g/mol. Its IUPAC name is N-[2-[(8aS)-2-amino-6,6-dimethyl-4,4a,5,8-tetrahydropyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-5-(difluoromethoxy)-3-methylpyridine-2-carboxamide.
| Compound Name | N-[2-[(8aS)-2-amino-6,6-dimethyl-4,4a,5,8-tetrahydropyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-5-(difluoromethoxy)-3-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 126731741 |
| Molecular Formula | C20H23F2N5O3S2 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | N-[2-[(8aS)-2-amino-6,6-dimethyl-4,4a,5,8-tetrahydropyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-5-(difluoromethoxy)-3-methylpyridine-2-carboxamide |
| SMILES | Cc1cc(OC(F)F)cnc1C(=O)Nc1csc([C@@]23COC(C)(C)CC2CSC(N)=N3)n1 |
| InChI | InChI=1S/C20H23F2N5O3S2/c1-10-4-12(30-17(21)22)6-24-14(10)15(28)25-13-8-31-16(26-13)20-9-29-19(2,3)5-11(20)7-32-18(23)27-20/h4,6,8,11,17H,5,7,9H2,1-3H3,(H2,23,27)(H,25,28)/t11?,20-/m1/s1 |
| InChIKey | HMGGVQLIMQGKBJ-ZRYLAOAESA-N |
| XLogP | 3.77 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |