C20H21F2N5O3S2 — CID 126732092
N-[2-[(8aS)-2-aminospiro[4,4a,5,8-tetrahydropyrano[3,4-d][1,3]thiazine-6,1'-cyclobutane]-8a-yl]-1,3-thiazol-4-yl]-5-(difluoromethoxy)pyridine-2-carboxamide (PubChem CID 126732092) has the molecular formula C20H21F2N5O3S2 and a molecular weight of 481.55 g/mol. Its IUPAC name is N-[2-[(8aS)-2-aminospiro[4,4a,5,8-tetrahydropyrano[3,4-d][1,3]thiazine-6,1'-cyclobutane]-8a-yl]-1,3-thiazol-4-yl]-5-(difluoromethoxy)pyridine-2-carboxamide.
| Compound Name | N-[2-[(8aS)-2-aminospiro[4,4a,5,8-tetrahydropyrano[3,4-d][1,3]thiazine-6,1'-cyclobutane]-8a-yl]-1,3-thiazol-4-yl]-5-(difluoromethoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 126732092 |
| Molecular Formula | C20H21F2N5O3S2 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | N-[2-[(8aS)-2-aminospiro[4,4a,5,8-tetrahydropyrano[3,4-d][1,3]thiazine-6,1'-cyclobutane]-8a-yl]-1,3-thiazol-4-yl]-5-(difluoromethoxy)pyridine-2-carboxamide |
| SMILES | NC1=N[C@]2(c3nc(NC(=O)c4ccc(OC(F)F)cn4)cs3)COC3(CCC3)CC2CS1 |
| InChI | InChI=1S/C20H21F2N5O3S2/c21-17(22)30-12-2-3-13(24-7-12)15(28)25-14-9-31-16(26-14)20-10-29-19(4-1-5-19)6-11(20)8-32-18(23)27-20/h2-3,7,9,11,17H,1,4-6,8,10H2,(H2,23,27)(H,25,28)/t11?,20-/m1/s1 |
| InChIKey | SATIASIZMQWBPO-ZRYLAOAESA-N |
| XLogP | 3.61 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |