C18H21N5O3S2 — CID 126732560
N-[2-[(4aR,8aR)-2-amino-6,6-dimethyl-4,4a,5,8-tetrahydropyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-5-hydroxypyridine-2-carboxamide (PubChem CID 126732560) has the molecular formula C18H21N5O3S2 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-[2-[(4aR,8aR)-2-amino-6,6-dimethyl-4,4a,5,8-tetrahydropyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-5-hydroxypyridine-2-carboxamide.
| Compound Name | N-[2-[(4aR,8aR)-2-amino-6,6-dimethyl-4,4a,5,8-tetrahydropyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-5-hydroxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 126732560 |
| Molecular Formula | C18H21N5O3S2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | N-[2-[(4aR,8aR)-2-amino-6,6-dimethyl-4,4a,5,8-tetrahydropyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-5-hydroxypyridine-2-carboxamide |
| SMILES | CC1(C)C[C@H]2CSC(N)=N[C@@]2(c2nc(NC(=O)c3ccc(O)cn3)cs2)CO1 |
| InChI | InChI=1S/C18H21N5O3S2/c1-17(2)5-10-7-28-16(19)23-18(10,9-26-17)15-22-13(8-27-15)21-14(25)12-4-3-11(24)6-20-12/h3-4,6,8,10,24H,5,7,9H2,1-2H3,(H2,19,23)(H,21,25)/t10-,18-/m0/s1 |
| InChIKey | LDOMHGCQSUSLPP-YPMLDQLKSA-N |
| XLogP | 2.57 |
| TPSA | 122.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |