C4H7OP — CID 126732441
buta-1,3-dien-2-yloxyphosphane (PubChem CID 126732441) has the molecular formula C4H7OP and a molecular weight of 102.07 g/mol. Its IUPAC name is buta-1,3-dien-2-yloxyphosphane.
| Compound Name | buta-1,3-dien-2-yloxyphosphane |
|---|---|
| PubChem CID | 126732441 |
| Molecular Formula | C4H7OP |
| Molecular Weight | 102.07 g/mol |
| Exact Mass | 102.02 |
| IUPAC Name | buta-1,3-dien-2-yloxyphosphane |
| SMILES | C=CC(=C)OP |
| InChI | InChI=1S/C4H7OP/c1-3-4(2)5-6/h3H,1-2,6H2 |
| InChIKey | CBPZVEZTNYNZEC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 102.07 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|