C14H12IN3OS — CID 126733656
[4-formyl-5,7-dimethyl-3-(1H-pyrazol-5-yl)indol-1-yl] thiohypoiodite (PubChem CID 126733656) has the molecular formula C14H12IN3OS and a molecular weight of 397.24 g/mol. Its IUPAC name is [4-formyl-5,7-dimethyl-3-(1H-pyrazol-5-yl)indol-1-yl] thiohypoiodite.
| Compound Name | [4-formyl-5,7-dimethyl-3-(1H-pyrazol-5-yl)indol-1-yl] thiohypoiodite |
|---|---|
| PubChem CID | 126733656 |
| Molecular Formula | C14H12IN3OS |
| Molecular Weight | 397.24 g/mol |
| Exact Mass | 396.97 |
| IUPAC Name | [4-formyl-5,7-dimethyl-3-(1H-pyrazol-5-yl)indol-1-yl] thiohypoiodite |
| SMILES | Cc1cc(C)c2c(c(-c3ccn[nH]3)cn2SI)c1C=O |
| InChI | InChI=1S/C14H12IN3OS/c1-8-5-9(2)14-13(11(8)7-19)10(6-18(14)20-15)12-3-4-16-17-12/h3-7H,1-2H3,(H,16,17) |
| InChIKey | RVHAHEGBZLFFQV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.24 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|