C21H20IN5S — CID 126733711
[4-[1-amino-1-(6-cyano-1H-benzimidazol-2-yl)ethyl]-5-ethyl-7-methylindol-1-yl] thiohypoiodite (PubChem CID 126733711) has the molecular formula C21H20IN5S and a molecular weight of 501.40 g/mol. Its IUPAC name is [4-[1-amino-1-(6-cyano-1H-benzimidazol-2-yl)ethyl]-5-ethyl-7-methylindol-1-yl] thiohypoiodite.
| Compound Name | [4-[1-amino-1-(6-cyano-1H-benzimidazol-2-yl)ethyl]-5-ethyl-7-methylindol-1-yl] thiohypoiodite |
|---|---|
| PubChem CID | 126733711 |
| Molecular Formula | C21H20IN5S |
| Molecular Weight | 501.40 g/mol |
| Exact Mass | 501.05 |
| IUPAC Name | [4-[1-amino-1-(6-cyano-1H-benzimidazol-2-yl)ethyl]-5-ethyl-7-methylindol-1-yl] thiohypoiodite |
| SMILES | CCc1cc(C)c2c(ccn2SI)c1C(C)(N)c1nc2ccc(C#N)cc2[nH]1 |
| InChI | InChI=1S/C21H20IN5S/c1-4-14-9-12(2)19-15(7-8-27(19)28-22)18(14)21(3,24)20-25-16-6-5-13(11-23)10-17(16)26-20/h5-10H,4,24H2,1-3H3,(H,25,26) |
| InChIKey | XUDISJGUZUXGAS-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 83.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.40 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|