C13H26O2 — CID 126735295
(3,3-dimethoxy-4-methylpentan-2-yl)cyclopentane (PubChem CID 126735295) has the molecular formula C13H26O2 and a molecular weight of 214.35 g/mol. Its IUPAC name is (3,3-dimethoxy-4-methylpentan-2-yl)cyclopentane.
| Compound Name | (3,3-dimethoxy-4-methylpentan-2-yl)cyclopentane |
|---|---|
| PubChem CID | 126735295 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | (3,3-dimethoxy-4-methylpentan-2-yl)cyclopentane |
| SMILES | COC(OC)(C(C)C)C(C)C1CCCC1 |
| InChI | InChI=1S/C13H26O2/c1-10(2)13(14-4,15-5)11(3)12-8-6-7-9-12/h10-12H,6-9H2,1-5H3 |
| InChIKey | YZEGYEBHCCLTES-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|