C11H24O2Si — CID 173326577
(2-cyclohexyl-1,1-dimethoxypropyl)silane (PubChem CID 173326577) has the molecular formula C11H24O2Si and a molecular weight of 216.40 g/mol. Its IUPAC name is (2-cyclohexyl-1,1-dimethoxypropyl)silane.
| Compound Name | (2-cyclohexyl-1,1-dimethoxypropyl)silane |
|---|---|
| PubChem CID | 173326577 |
| Molecular Formula | C11H24O2Si |
| Molecular Weight | 216.40 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (2-cyclohexyl-1,1-dimethoxypropyl)silane |
| SMILES | COC([SiH3])(OC)C(C)C1CCCCC1 |
| InChI | InChI=1S/C11H24O2Si/c1-9(11(14,12-2)13-3)10-7-5-4-6-8-10/h9-10H,4-8H2,1-3,14H3 |
| InChIKey | RVMZFIUCCIDPFU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|