C49H40N6O2 — CID 126736293
2-[(1E,3E,5Z)-1-(10-ethylphenazin-5-yl)hepta-1,3,5-trien-4-yl]-6-[4-(10-ethylphenazin-5-yl)phenyl]-[1,3]oxazolo[5,4-f][1,3]benzoxazole (PubChem CID 126736293) has the molecular formula C49H40N6O2 and a molecular weight of 744.90 g/mol. Its IUPAC name is 2-[(1E,3E,5Z)-1-(10-ethylphenazin-5-yl)hepta-1,3,5-trien-4-yl]-6-[4-(10-ethylphenazin-5-yl)phenyl]-[1,3]oxazolo[5,4-f][1,3]benzoxazole.
| Compound Name | 2-[(1E,3E,5Z)-1-(10-ethylphenazin-5-yl)hepta-1,3,5-trien-4-yl]-6-[4-(10-ethylphenazin-5-yl)phenyl]-[1,3]oxazolo[5,4-f][1,3]benzoxazole |
|---|---|
| PubChem CID | 126736293 |
| Molecular Formula | C49H40N6O2 |
| Molecular Weight | 744.90 g/mol |
| Exact Mass | 744.32 |
| IUPAC Name | 2-[(1E,3E,5Z)-1-(10-ethylphenazin-5-yl)hepta-1,3,5-trien-4-yl]-6-[4-(10-ethylphenazin-5-yl)phenyl]-[1,3]oxazolo[5,4-f][1,3]benzoxazole |
| SMILES | C/C=C\C(=C/C=C/N1c2ccccc2N(CC)c2ccccc21)c1nc2cc3oc(-c4ccc(N5c6ccccc6N(CC)c6ccccc65)cc4)nc3cc2o1 |
| InChI | InChI=1S/C49H40N6O2/c1-4-16-33(17-15-30-54-40-20-9-7-18-38(40)52(5-2)39-19-8-10-21-41(39)54)48-50-36-31-47-37(32-46(36)56-48)51-49(57-47)34-26-28-35(29-27-34)55-44-24-13-11-22-42(44)53(6-3)43-23-12-14-25-45(43)55/h4,7-32H,5-6H2,1-3H3/b16-4-,30-15+,33-17+ |
| InChIKey | SHFAROYVJFKVDG-IKPBAFGXSA-N |
| XLogP | 13.36 |
| TPSA | 65.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.90 |
| LogP ≤ 5 | 13.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|