C22H31N3O3 — CID 126736383
1-[1-(4,8-dimethoxynaphthalen-1-yl)ethyl]-3-(1-ethylpiperidin-4-yl)urea (PubChem CID 126736383) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is 1-[1-(4,8-dimethoxynaphthalen-1-yl)ethyl]-3-(1-ethylpiperidin-4-yl)urea.
| Compound Name | 1-[1-(4,8-dimethoxynaphthalen-1-yl)ethyl]-3-(1-ethylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 126736383 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 1-[1-(4,8-dimethoxynaphthalen-1-yl)ethyl]-3-(1-ethylpiperidin-4-yl)urea |
| SMILES | CCN1CCC(NC(=O)NC(C)c2ccc(OC)c3cccc(OC)c23)CC1 |
| InChI | InChI=1S/C22H31N3O3/c1-5-25-13-11-16(12-14-25)24-22(26)23-15(2)17-9-10-19(27-3)18-7-6-8-20(28-4)21(17)18/h6-10,15-16H,5,11-14H2,1-4H3,(H2,23,24,26) |
| InChIKey | PYUHKPRMCVGOEH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |