C27H28N6O2S — CID 126737302
N-[5-[(cyclohexylamino)methyl]-1-[3-(prop-2-enoylamino)phenyl]benzimidazol-2-yl]-1,2-thiazole-5-carboxamide (PubChem CID 126737302) has the molecular formula C27H28N6O2S and a molecular weight of 500.63 g/mol. Its IUPAC name is N-[5-[(cyclohexylamino)methyl]-1-[3-(prop-2-enoylamino)phenyl]benzimidazol-2-yl]-1,2-thiazole-5-carboxamide.
| Compound Name | N-[5-[(cyclohexylamino)methyl]-1-[3-(prop-2-enoylamino)phenyl]benzimidazol-2-yl]-1,2-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 126737302 |
| Molecular Formula | C27H28N6O2S |
| Molecular Weight | 500.63 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | N-[5-[(cyclohexylamino)methyl]-1-[3-(prop-2-enoylamino)phenyl]benzimidazol-2-yl]-1,2-thiazole-5-carboxamide |
| SMILES | C=CC(=O)Nc1cccc(-n2c(NC(=O)c3ccns3)nc3cc(CNC4CCCCC4)ccc32)c1 |
| InChI | InChI=1S/C27H28N6O2S/c1-2-25(34)30-20-9-6-10-21(16-20)33-23-12-11-18(17-28-19-7-4-3-5-8-19)15-22(23)31-27(33)32-26(35)24-13-14-29-36-24/h2,6,9-16,19,28H,1,3-5,7-8,17H2,(H,30,34)(H,31,32,35) |
| InChIKey | BTDNCFRRUONCAK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.63 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|