C31H32N6O2 — CID 126738073
4-cyano-N-[5-[[[(2S)-3,3-dimethylbutan-2-yl]amino]methyl]-1-[3-(prop-2-enoylamino)phenyl]benzimidazol-2-yl]benzamide (PubChem CID 126738073) has the molecular formula C31H32N6O2 and a molecular weight of 520.64 g/mol. Its IUPAC name is 4-cyano-N-[5-[[[(2S)-3,3-dimethylbutan-2-yl]amino]methyl]-1-[3-(prop-2-enoylamino)phenyl]benzimidazol-2-yl]benzamide.
| Compound Name | 4-cyano-N-[5-[[[(2S)-3,3-dimethylbutan-2-yl]amino]methyl]-1-[3-(prop-2-enoylamino)phenyl]benzimidazol-2-yl]benzamide |
|---|---|
| PubChem CID | 126738073 |
| Molecular Formula | C31H32N6O2 |
| Molecular Weight | 520.64 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | 4-cyano-N-[5-[[[(2S)-3,3-dimethylbutan-2-yl]amino]methyl]-1-[3-(prop-2-enoylamino)phenyl]benzimidazol-2-yl]benzamide |
| SMILES | C=CC(=O)Nc1cccc(-n2c(NC(=O)c3ccc(C#N)cc3)nc3cc(CN[C@@H](C)C(C)(C)C)ccc32)c1 |
| InChI | InChI=1S/C31H32N6O2/c1-6-28(38)34-24-8-7-9-25(17-24)37-27-15-12-22(19-33-20(2)31(3,4)5)16-26(27)35-30(37)36-29(39)23-13-10-21(18-32)11-14-23/h6-17,20,33H,1,19H2,2-5H3,(H,34,38)(H,35,36,39)/t20-/m0/s1 |
| InChIKey | GCHDPGCEBXOBPL-FQEVSTJZSA-N |
| XLogP | 5.80 |
| TPSA | 111.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.64 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|