C23H19N3O5S — CID 126737915
2-[3-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-N-(4-formyl-1,3-thiazol-2-yl)acetamide (PubChem CID 126737915) has the molecular formula C23H19N3O5S and a molecular weight of 449.49 g/mol. Its IUPAC name is 2-[3-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-N-(4-formyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[3-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-N-(4-formyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 126737915 |
| Molecular Formula | C23H19N3O5S |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | 2-[3-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-N-(4-formyl-1,3-thiazol-2-yl)acetamide |
| SMILES | COc1cc2nccc(Oc3cccc(CC(=O)Nc4nc(C=O)cs4)c3)c2cc1OC |
| InChI | InChI=1S/C23H19N3O5S/c1-29-20-10-17-18(11-21(20)30-2)24-7-6-19(17)31-16-5-3-4-14(8-16)9-22(28)26-23-25-15(12-27)13-32-23/h3-8,10-13H,9H2,1-2H3,(H,25,26,28) |
| InChIKey | QIXUTUKARSSTRR-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|