C12H13N3O4 — CID 126741494
(E)-4-(2-morpholin-4-ylpyrimidin-5-yl)-2-oxobut-3-enoic acid (PubChem CID 126741494) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is (E)-4-(2-morpholin-4-ylpyrimidin-5-yl)-2-oxobut-3-enoic acid.
| Compound Name | (E)-4-(2-morpholin-4-ylpyrimidin-5-yl)-2-oxobut-3-enoic acid |
|---|---|
| PubChem CID | 126741494 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | (E)-4-(2-morpholin-4-ylpyrimidin-5-yl)-2-oxobut-3-enoic acid |
| SMILES | O=C(O)C(=O)/C=C/c1cnc(N2CCOCC2)nc1 |
| InChI | InChI=1S/C12H13N3O4/c16-10(11(17)18)2-1-9-7-13-12(14-8-9)15-3-5-19-6-4-15/h1-2,7-8H,3-6H2,(H,17,18)/b2-1+ |
| InChIKey | HXHJZDKOFDGSLB-OWOJBTEDSA-N |
| XLogP | -0.02 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|