C13H16FN6O7P — CID 126742475
(2S)-2-[[(4aR,7aS)-6-(6-amino-2-fluoropurin-9-yl)-7-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]propanoic acid (PubChem CID 126742475) has the molecular formula C13H16FN6O7P and a molecular weight of 418.28 g/mol. Its IUPAC name is (2S)-2-[[(4aR,7aS)-6-(6-amino-2-fluoropurin-9-yl)-7-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(4aR,7aS)-6-(6-amino-2-fluoropurin-9-yl)-7-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 126742475 |
| Molecular Formula | C13H16FN6O7P |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | (2S)-2-[[(4aR,7aS)-6-(6-amino-2-fluoropurin-9-yl)-7-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]propanoic acid |
| SMILES | C[C@H](NP1(=O)OC[C@H]2OC(n3cnc4c(N)nc(F)nc43)C(O)[C@@H]2O1)C(=O)O |
| InChI | InChI=1S/C13H16FN6O7P/c1-4(12(22)23)19-28(24)25-2-5-8(27-28)7(21)11(26-5)20-3-16-6-9(15)17-13(14)18-10(6)20/h3-5,7-8,11,21H,2H2,1H3,(H,19,24)(H,22,23)(H2,15,17,18)/t4-,5+,7?,8+,11?,28?/m0/s1 |
| InChIKey | OLHLFJYJDLICID-HLBOZTFASA-N |
| XLogP | -0.61 |
| TPSA | 183.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|