C25H39N3O3 — CID 126746108
2,2,4,4,10,10,12,12-octamethyl-11-phenoxy-7-oxa-3,11,14-triazadispiro[5.1.58.26]pentadecan-15-one (PubChem CID 126746108) has the molecular formula C25H39N3O3 and a molecular weight of 429.61 g/mol. Its IUPAC name is 2,2,4,4,10,10,12,12-octamethyl-11-phenoxy-7-oxa-3,11,14-triazadispiro[5.1.58.26]pentadecan-15-one.
| Compound Name | 2,2,4,4,10,10,12,12-octamethyl-11-phenoxy-7-oxa-3,11,14-triazadispiro[5.1.58.26]pentadecan-15-one |
|---|---|
| PubChem CID | 126746108 |
| Molecular Formula | C25H39N3O3 |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.30 |
| IUPAC Name | 2,2,4,4,10,10,12,12-octamethyl-11-phenoxy-7-oxa-3,11,14-triazadispiro[5.1.58.26]pentadecan-15-one |
| SMILES | CC1(C)CC2(CC(C)(C)N1)OC1(CC(C)(C)N(Oc3ccccc3)C(C)(C)C1)NC2=O |
| InChI | InChI=1S/C25H39N3O3/c1-20(2)14-24(15-21(3,4)27-20)19(29)26-25(31-24)16-22(5,6)28(23(7,8)17-25)30-18-12-10-9-11-13-18/h9-13,27H,14-17H2,1-8H3,(H,26,29) |
| InChIKey | TUFQTZALTVWTCP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |