C29H48N4O8 — CID 151434965
3,3-bis(2,7,7,9,9-pentamethyl-4-oxo-1-oxa-3,8-diazaspiro[4.5]decan-2-yl)-1,4-dioxane-2-carboxylic acid (PubChem CID 151434965) has the molecular formula C29H48N4O8 and a molecular weight of 580.72 g/mol. Its IUPAC name is 3,3-bis(2,7,7,9,9-pentamethyl-4-oxo-1-oxa-3,8-diazaspiro[4.5]decan-2-yl)-1,4-dioxane-2-carboxylic acid.
| Compound Name | 3,3-bis(2,7,7,9,9-pentamethyl-4-oxo-1-oxa-3,8-diazaspiro[4.5]decan-2-yl)-1,4-dioxane-2-carboxylic acid |
|---|---|
| PubChem CID | 151434965 |
| Molecular Formula | C29H48N4O8 |
| Molecular Weight | 580.72 g/mol |
| Exact Mass | 580.35 |
| IUPAC Name | 3,3-bis(2,7,7,9,9-pentamethyl-4-oxo-1-oxa-3,8-diazaspiro[4.5]decan-2-yl)-1,4-dioxane-2-carboxylic acid |
| SMILES | CC1(C)CC2(CC(C)(C)N1)OC(C)(C1(C3(C)NC(=O)C4(CC(C)(C)NC(C)(C)C4)O3)OCCOC1C(=O)O)NC2=O |
| InChI | InChI=1S/C29H48N4O8/c1-21(2)13-27(14-22(3,4)32-21)19(36)30-25(9,40-27)29(17(18(34)35)38-11-12-39-29)26(10)31-20(37)28(41-26)15-23(5,6)33-24(7,8)16-28/h17,32-33H,11-16H2,1-10H3,(H,30,36)(H,31,37)(H,34,35) |
| InChIKey | PDHLOVYYEXPOGS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 156.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.72 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |