C25H45N3O2U — CID 161497400
cyclohexane;2,2,4,4,10,10,12,12-octamethyl-7-oxa-3,14-diaza-11-azanidadispiro[5.1.58.26]pentadecan-15-one;uranium(2+) (PubChem CID 161497400) has the molecular formula C25H45N3O2U and a molecular weight of 657.68 g/mol. Its IUPAC name is cyclohexane;2,2,4,4,10,10,12,12-octamethyl-7-oxa-3,14-diaza-11-azanidadispiro[5.1.58.26]pentadecan-15-one;uranium(2+).
| Compound Name | cyclohexane;2,2,4,4,10,10,12,12-octamethyl-7-oxa-3,14-diaza-11-azanidadispiro[5.1.58.26]pentadecan-15-one;uranium(2+) |
|---|---|
| PubChem CID | 161497400 |
| Molecular Formula | C25H45N3O2U |
| Molecular Weight | 657.68 g/mol |
| Exact Mass | 657.40 |
| IUPAC Name | cyclohexane;2,2,4,4,10,10,12,12-octamethyl-7-oxa-3,14-diaza-11-azanidadispiro[5.1.58.26]pentadecan-15-one;uranium(2+) |
| SMILES | CC1(C)CC2(CC(C)(C)[N-]1)NC(=O)C1(CC(C)(C)NC(C)(C)C1)O2.[CH-]1CCCCC1.[U+2] |
| InChI | InChI=1S/C19H34N3O2.C6H11.U/c1-14(2)9-18(10-15(3,4)21-14)13(23)20-19(24-18)11-16(5,6)22-17(7,8)12-19;1-2-4-6-5-3-1;/h21H,9-12H2,1-8H3,(H,20,23);1H,2-6H2;/q2*-1;+2 |
| InChIKey | GHAJNVHNWTXPFA-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 64.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.68 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|