C22H39ClN2O3 — CID 159242230
2-(chloromethyl)oxirane;2,2,4,4-tetramethyl-7-oxa-3,17-diazadispiro[5.1.88.26]octadecan-18-one (PubChem CID 159242230) has the molecular formula C22H39ClN2O3 and a molecular weight of 415.02 g/mol. Its IUPAC name is 2-(chloromethyl)oxirane;2,2,4,4-tetramethyl-7-oxa-3,17-diazadispiro[5.1.88.26]octadecan-18-one.
| Compound Name | 2-(chloromethyl)oxirane;2,2,4,4-tetramethyl-7-oxa-3,17-diazadispiro[5.1.88.26]octadecan-18-one |
|---|---|
| PubChem CID | 159242230 |
| Molecular Formula | C22H39ClN2O3 |
| Molecular Weight | 415.02 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | 2-(chloromethyl)oxirane;2,2,4,4-tetramethyl-7-oxa-3,17-diazadispiro[5.1.88.26]octadecan-18-one |
| SMILES | CC1(C)CC2(CC(C)(C)N1)OC1(CCCCCCCC1)NC2=O.ClCC1CO1 |
| InChI | InChI=1S/C19H34N2O2.C3H5ClO/c1-16(2)13-18(14-17(3,4)21-16)15(22)20-19(23-18)11-9-7-5-6-8-10-12-19;4-1-3-2-5-3/h21H,5-14H2,1-4H3,(H,20,22);3H,1-2H2 |
| InChIKey | KUFVQWVTKUJCAY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 62.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.02 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|