About hex-5-ynyl carbonofluoridate
hex-5-ynyl carbonofluoridate (PubChem CID 126746142) has the molecular formula C7H9FO2
and a molecular weight of 144.15 g/mol. Its IUPAC name is hex-5-ynyl carbonofluoridate.
Molecular Properties
| Compound Name | hex-5-ynyl carbonofluoridate |
| PubChem CID | 126746142 |
| Molecular Formula | C7H9FO2 |
| Molecular Weight | 144.15 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | hex-5-ynyl carbonofluoridate |
| SMILES | C#CCCCCOC(=O)F |
| InChI | InChI=1S/C7H9FO2/c1-2-3-4-5-6-10-7(8)9/h1H,3-6H2 |
| InChIKey | RNHQPDCOUCODEY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.15 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze hex-5-ynyl carbonofluoridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-5-ynyl carbonofluoridate?
The IUPAC name of hex-5-ynyl carbonofluoridate (CID 126746142) is hex-5-ynyl carbonofluoridate.
What is the SMILES notation for hex-5-ynyl carbonofluoridate?
The canonical SMILES for hex-5-ynyl carbonofluoridate is C#CCCCCOC(=O)F.
What is the InChIKey of hex-5-ynyl carbonofluoridate?
The InChIKey is RNHQPDCOUCODEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9FO2/c1-2-3-4-5-6-10-7(8)9/h1H,3-6H2.
What are the key properties of hex-5-ynyl carbonofluoridate?
hex-5-ynyl carbonofluoridate has a molecular weight of 144.15 g/mol, XLogP of 1.90, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hex-5-ynyl carbonofluoridate is sourced from PubChem (CID 126746142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).