C33H37FO4 — CID 126747696
4-[(2R)-6-[(6R)-9-[2-(4-fluorophenoxy)ethyl]-5,6,7,8,9,10-hexahydrobenzo[8]annulen-6-yl]-6-oxohexan-2-yl]benzoic acid (PubChem CID 126747696) has the molecular formula C33H37FO4 and a molecular weight of 516.65 g/mol. Its IUPAC name is 4-[(2R)-6-[(6R)-9-[2-(4-fluorophenoxy)ethyl]-5,6,7,8,9,10-hexahydrobenzo[8]annulen-6-yl]-6-oxohexan-2-yl]benzoic acid.
| Compound Name | 4-[(2R)-6-[(6R)-9-[2-(4-fluorophenoxy)ethyl]-5,6,7,8,9,10-hexahydrobenzo[8]annulen-6-yl]-6-oxohexan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 126747696 |
| Molecular Formula | C33H37FO4 |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | 4-[(2R)-6-[(6R)-9-[2-(4-fluorophenoxy)ethyl]-5,6,7,8,9,10-hexahydrobenzo[8]annulen-6-yl]-6-oxohexan-2-yl]benzoic acid |
| SMILES | C[C@H](CCCC(=O)[C@@H]1CCC(CCOc2ccc(F)cc2)Cc2ccccc2C1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C33H37FO4/c1-23(25-11-13-26(14-12-25)33(36)37)5-4-8-32(35)29-10-9-24(21-27-6-2-3-7-28(27)22-29)19-20-38-31-17-15-30(34)16-18-31/h2-3,6-7,11-18,23-24,29H,4-5,8-10,19-22H2,1H3,(H,36,37)/t23-,24?,29-/m1/s1 |
| InChIKey | VMUPHJBXVKMQHB-KCYCSPNPSA-N |
| XLogP | 7.65 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |