C21H24F3N3 — CID 126749190
2-[3-[1-[3-[4-(trifluoromethyl)phenyl]pyrrolidin-1-yl]ethenyl]pyrrolidin-1-yl]-1H-pyrrole (PubChem CID 126749190) has the molecular formula C21H24F3N3 and a molecular weight of 375.44 g/mol. Its IUPAC name is 2-[3-[1-[3-[4-(trifluoromethyl)phenyl]pyrrolidin-1-yl]ethenyl]pyrrolidin-1-yl]-1H-pyrrole.
| Compound Name | 2-[3-[1-[3-[4-(trifluoromethyl)phenyl]pyrrolidin-1-yl]ethenyl]pyrrolidin-1-yl]-1H-pyrrole |
|---|---|
| PubChem CID | 126749190 |
| Molecular Formula | C21H24F3N3 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 2-[3-[1-[3-[4-(trifluoromethyl)phenyl]pyrrolidin-1-yl]ethenyl]pyrrolidin-1-yl]-1H-pyrrole |
| SMILES | C=C(C1CCN(c2ccc[nH]2)C1)N1CCC(c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C21H24F3N3/c1-15(17-8-12-27(13-17)20-3-2-10-25-20)26-11-9-18(14-26)16-4-6-19(7-5-16)21(22,23)24/h2-7,10,17-18,25H,1,8-9,11-14H2 |
| InChIKey | YAUGXOLWMVJLAE-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |