C22H31F3N2 — CID 126749255
1-[1-(1-tert-butylpyrrolidin-3-yl)ethenyl]-4-[4-(trifluoromethyl)phenyl]piperidine (PubChem CID 126749255) has the molecular formula C22H31F3N2 and a molecular weight of 380.50 g/mol. Its IUPAC name is 1-[1-(1-tert-butylpyrrolidin-3-yl)ethenyl]-4-[4-(trifluoromethyl)phenyl]piperidine.
| Compound Name | 1-[1-(1-tert-butylpyrrolidin-3-yl)ethenyl]-4-[4-(trifluoromethyl)phenyl]piperidine |
|---|---|
| PubChem CID | 126749255 |
| Molecular Formula | C22H31F3N2 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | 1-[1-(1-tert-butylpyrrolidin-3-yl)ethenyl]-4-[4-(trifluoromethyl)phenyl]piperidine |
| SMILES | C=C(C1CCN(C(C)(C)C)C1)N1CCC(c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C22H31F3N2/c1-16(19-11-14-27(15-19)21(2,3)4)26-12-9-18(10-13-26)17-5-7-20(8-6-17)22(23,24)25/h5-8,18-19H,1,9-15H2,2-4H3 |
| InChIKey | RFPYREPQSJERPL-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |