C22H26FNO3 — CID 126752506
[4-[2-fluoro-5-(2-methylbutan-2-yloxy)phenyl]phenyl]-morpholin-4-ylmethanone (PubChem CID 126752506) has the molecular formula C22H26FNO3 and a molecular weight of 371.45 g/mol. Its IUPAC name is [4-[2-fluoro-5-(2-methylbutan-2-yloxy)phenyl]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-[2-fluoro-5-(2-methylbutan-2-yloxy)phenyl]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 126752506 |
| Molecular Formula | C22H26FNO3 |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | [4-[2-fluoro-5-(2-methylbutan-2-yloxy)phenyl]phenyl]-morpholin-4-ylmethanone |
| SMILES | CCC(C)(C)Oc1ccc(F)c(-c2ccc(C(=O)N3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C22H26FNO3/c1-4-22(2,3)27-18-9-10-20(23)19(15-18)16-5-7-17(8-6-16)21(25)24-11-13-26-14-12-24/h5-10,15H,4,11-14H2,1-3H3 |
| InChIKey | RLKSVNCCZCKSQF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |