C14H23N3 — CID 126756997
(3S)-1,3,4-trimethyl-6-pyrrolidin-1-yl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine (PubChem CID 126756997) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is (3S)-1,3,4-trimethyl-6-pyrrolidin-1-yl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine.
| Compound Name | (3S)-1,3,4-trimethyl-6-pyrrolidin-1-yl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine |
|---|---|
| PubChem CID | 126756997 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | (3S)-1,3,4-trimethyl-6-pyrrolidin-1-yl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine |
| SMILES | CC1=N[C@@H](C)C(C)=C2CC(N3CCCC3)CN12 |
| InChI | InChI=1S/C14H23N3/c1-10-11(2)15-12(3)17-9-13(8-14(10)17)16-6-4-5-7-16/h11,13H,4-9H2,1-3H3/t11-,13?/m0/s1 |
| InChIKey | LYADBBZOFMGLBQ-AMGKYWFPSA-N |
| XLogP | 2.25 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |