C15H25N3O2S — CID 130218348
N-(1,3,4-trimethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl)cyclopentanesulfonamide (PubChem CID 130218348) has the molecular formula C15H25N3O2S and a molecular weight of 311.45 g/mol. Its IUPAC name is N-(1,3,4-trimethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl)cyclopentanesulfonamide.
| Compound Name | N-(1,3,4-trimethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl)cyclopentanesulfonamide |
|---|---|
| PubChem CID | 130218348 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | N-(1,3,4-trimethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl)cyclopentanesulfonamide |
| SMILES | CC1=NC(C)C(C)=C2CC(NS(=O)(=O)C3CCCC3)CN12 |
| InChI | InChI=1S/C15H25N3O2S/c1-10-11(2)16-12(3)18-9-13(8-15(10)18)17-21(19,20)14-6-4-5-7-14/h11,13-14,17H,4-9H2,1-3H3 |
| InChIKey | PENJTYAALQKWOH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |