C12H21N3O2S — CID 130218367
N-[[(3S)-1,3,4-trimethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methyl]methanesulfonamide (PubChem CID 130218367) has the molecular formula C12H21N3O2S and a molecular weight of 271.39 g/mol. Its IUPAC name is N-[[(3S)-1,3,4-trimethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methyl]methanesulfonamide.
| Compound Name | N-[[(3S)-1,3,4-trimethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 130218367 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | N-[[(3S)-1,3,4-trimethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methyl]methanesulfonamide |
| SMILES | CC1=N[C@@H](C)C(C)=C2CC(CNS(C)(=O)=O)CN12 |
| InChI | InChI=1S/C12H21N3O2S/c1-8-9(2)14-10(3)15-7-11(5-12(8)15)6-13-18(4,16)17/h9,11,13H,5-7H2,1-4H3/t9-,11?/m0/s1 |
| InChIKey | MFHFJTDKXYTPGK-FTNKSUMCSA-N |
| XLogP | 0.95 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |