C10H16N2O — CID 130219048
(3S,6S)-1,3,4-trimethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-ol (PubChem CID 130219048) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is (3S,6S)-1,3,4-trimethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-ol.
| Compound Name | (3S,6S)-1,3,4-trimethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-ol |
|---|---|
| PubChem CID | 130219048 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | (3S,6S)-1,3,4-trimethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-ol |
| SMILES | CC1=N[C@@H](C)C(C)=C2C[C@H](O)CN12 |
| InChI | InChI=1S/C10H16N2O/c1-6-7(2)11-8(3)12-5-9(13)4-10(6)12/h7,9,13H,4-5H2,1-3H3/t7-,9-/m0/s1 |
| InChIKey | XWNPWAWXIJTLTJ-CBAPKCEASA-N |
| XLogP | 1.15 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |