C11H18N2O — CID 130218583
[(3S,6S)-1,3,4-trimethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methanol (PubChem CID 130218583) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is [(3S,6S)-1,3,4-trimethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methanol.
| Compound Name | [(3S,6S)-1,3,4-trimethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methanol |
|---|---|
| PubChem CID | 130218583 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | [(3S,6S)-1,3,4-trimethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methanol |
| SMILES | CC1=N[C@@H](C)C(C)=C2C[C@H](CO)CN12 |
| InChI | InChI=1S/C11H18N2O/c1-7-8(2)12-9(3)13-5-10(6-14)4-11(7)13/h8,10,14H,4-6H2,1-3H3/t8-,10-/m0/s1 |
| InChIKey | NMWHAMWMNSAOOJ-WPRPVWTQSA-N |
| XLogP | 1.40 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |