C17H30N2O — CID 130208835
[(3R,6R)-1,4-ditert-butyl-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methanol (PubChem CID 130208835) has the molecular formula C17H30N2O and a molecular weight of 278.44 g/mol. Its IUPAC name is [(3R,6R)-1,4-ditert-butyl-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methanol.
| Compound Name | [(3R,6R)-1,4-ditert-butyl-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methanol |
|---|---|
| PubChem CID | 130208835 |
| Molecular Formula | C17H30N2O |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | [(3R,6R)-1,4-ditert-butyl-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methanol |
| SMILES | C[C@H]1N=C(C(C)(C)C)N2C[C@H](CO)CC2=C1C(C)(C)C |
| InChI | InChI=1S/C17H30N2O/c1-11-14(16(2,3)4)13-8-12(10-20)9-19(13)15(18-11)17(5,6)7/h11-12,20H,8-10H2,1-7H3/t11-,12-/m1/s1 |
| InChIKey | CMCSFBNGEFCBAU-VXGBXAGGSA-N |
| XLogP | 3.45 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |