C17H27N3 — CID 130208855
(3R,6R)-1,4-ditert-butyl-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-6-carbonitrile (PubChem CID 130208855) has the molecular formula C17H27N3 and a molecular weight of 273.42 g/mol. Its IUPAC name is (3R,6R)-1,4-ditert-butyl-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-6-carbonitrile.
| Compound Name | (3R,6R)-1,4-ditert-butyl-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 130208855 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | (3R,6R)-1,4-ditert-butyl-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-6-carbonitrile |
| SMILES | C[C@H]1N=C(C(C)(C)C)N2C[C@H](C#N)CC2=C1C(C)(C)C |
| InChI | InChI=1S/C17H27N3/c1-11-14(16(2,3)4)13-8-12(9-18)10-20(13)15(19-11)17(5,6)7/h11-12H,8,10H2,1-7H3/t11-,12+/m1/s1 |
| InChIKey | FGTSLQQVWZKKEA-NEPJUHHUSA-N |
| XLogP | 3.98 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |