C17H32N4O2S — CID 130208894
(3S,6S)-1,4-ditert-butyl-3-methyl-N-(methylsulfamoyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-amine (PubChem CID 130208894) has the molecular formula C17H32N4O2S and a molecular weight of 356.54 g/mol. Its IUPAC name is (3S,6S)-1,4-ditert-butyl-3-methyl-N-(methylsulfamoyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-amine.
| Compound Name | (3S,6S)-1,4-ditert-butyl-3-methyl-N-(methylsulfamoyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-amine |
|---|---|
| PubChem CID | 130208894 |
| Molecular Formula | C17H32N4O2S |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | (3S,6S)-1,4-ditert-butyl-3-methyl-N-(methylsulfamoyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-amine |
| SMILES | CNS(=O)(=O)N[C@H]1CC2=C(C(C)(C)C)[C@H](C)N=C(C(C)(C)C)N2C1 |
| InChI | InChI=1S/C17H32N4O2S/c1-11-14(16(2,3)4)13-9-12(20-24(22,23)18-8)10-21(13)15(19-11)17(5,6)7/h11-12,18,20H,9-10H2,1-8H3/t11-,12-/m0/s1 |
| InChIKey | GFSMTBCOIQPTJQ-RYUDHWBXSA-N |
| XLogP | 2.26 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |