C18H31N3O — CID 130208882
N-[(3S,6R)-1,4-ditert-butyl-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]acetamide (PubChem CID 130208882) has the molecular formula C18H31N3O and a molecular weight of 305.47 g/mol. Its IUPAC name is N-[(3S,6R)-1,4-ditert-butyl-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]acetamide.
| Compound Name | N-[(3S,6R)-1,4-ditert-butyl-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]acetamide |
|---|---|
| PubChem CID | 130208882 |
| Molecular Formula | C18H31N3O |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.25 |
| IUPAC Name | N-[(3S,6R)-1,4-ditert-butyl-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1CC2=C(C(C)(C)C)[C@H](C)N=C(C(C)(C)C)N2C1 |
| InChI | InChI=1S/C18H31N3O/c1-11-15(17(3,4)5)14-9-13(20-12(2)22)10-21(14)16(19-11)18(6,7)8/h11,13H,9-10H2,1-8H3,(H,20,22)/t11-,13+/m0/s1 |
| InChIKey | OGPBJXWEGWPVIC-WCQYABFASA-N |
| XLogP | 3.34 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |