C20H36N4O — CID 130218724
1-[(3S,6S)-1,4-ditert-butyl-3-propan-2-yl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]-3-methylurea (PubChem CID 130218724) has the molecular formula C20H36N4O and a molecular weight of 348.54 g/mol. Its IUPAC name is 1-[(3S,6S)-1,4-ditert-butyl-3-propan-2-yl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]-3-methylurea.
| Compound Name | 1-[(3S,6S)-1,4-ditert-butyl-3-propan-2-yl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]-3-methylurea |
|---|---|
| PubChem CID | 130218724 |
| Molecular Formula | C20H36N4O |
| Molecular Weight | 348.54 g/mol |
| Exact Mass | 348.29 |
| IUPAC Name | 1-[(3S,6S)-1,4-ditert-butyl-3-propan-2-yl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]-3-methylurea |
| SMILES | CNC(=O)N[C@H]1CC2=C(C(C)(C)C)[C@H](C(C)C)N=C(C(C)(C)C)N2C1 |
| InChI | InChI=1S/C20H36N4O/c1-12(2)16-15(19(3,4)5)14-10-13(22-18(25)21-9)11-24(14)17(23-16)20(6,7)8/h12-13,16H,10-11H2,1-9H3,(H2,21,22,25)/t13-,16-/m0/s1 |
| InChIKey | YMGIFLRVNPDWHC-BBRMVZONSA-N |
| XLogP | 3.77 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |