C23H39N3O2 — CID 130208713
N-(1,3,4-tritert-butyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl)oxetane-3-carboxamide (PubChem CID 130208713) has the molecular formula C23H39N3O2 and a molecular weight of 389.58 g/mol. Its IUPAC name is N-(1,3,4-tritert-butyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl)oxetane-3-carboxamide.
| Compound Name | N-(1,3,4-tritert-butyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl)oxetane-3-carboxamide |
|---|---|
| PubChem CID | 130208713 |
| Molecular Formula | C23H39N3O2 |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.30 |
| IUPAC Name | N-(1,3,4-tritert-butyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl)oxetane-3-carboxamide |
| SMILES | CC(C)(C)C1=NC(C(C)(C)C)C(C(C)(C)C)=C2CC(NC(=O)C3COC3)CN12 |
| InChI | InChI=1S/C23H39N3O2/c1-21(2,3)17-16-10-15(24-19(27)14-12-28-13-14)11-26(16)20(23(7,8)9)25-18(17)22(4,5)6/h14-15,18H,10-13H2,1-9H3,(H,24,27) |
| InChIKey | LEZFNFVAROSTLA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |