C24H41N3O2 — CID 130208785
(3-methyloxetan-3-yl)-(6,8,9-tritert-butyl-1,3,4,8-tetrahydropyrazino[1,2-c]pyrimidin-2-yl)methanone (PubChem CID 130208785) has the molecular formula C24H41N3O2 and a molecular weight of 403.61 g/mol. Its IUPAC name is (3-methyloxetan-3-yl)-(6,8,9-tritert-butyl-1,3,4,8-tetrahydropyrazino[1,2-c]pyrimidin-2-yl)methanone.
| Compound Name | (3-methyloxetan-3-yl)-(6,8,9-tritert-butyl-1,3,4,8-tetrahydropyrazino[1,2-c]pyrimidin-2-yl)methanone |
|---|---|
| PubChem CID | 130208785 |
| Molecular Formula | C24H41N3O2 |
| Molecular Weight | 403.61 g/mol |
| Exact Mass | 403.32 |
| IUPAC Name | (3-methyloxetan-3-yl)-(6,8,9-tritert-butyl-1,3,4,8-tetrahydropyrazino[1,2-c]pyrimidin-2-yl)methanone |
| SMILES | CC(C)(C)C1=NC(C(C)(C)C)C(C(C)(C)C)=C2CN(C(=O)C3(C)COC3)CCN12 |
| InChI | InChI=1S/C24H41N3O2/c1-21(2,3)17-16-13-26(20(28)24(10)14-29-15-24)11-12-27(16)19(23(7,8)9)25-18(17)22(4,5)6/h18H,11-15H2,1-10H3 |
| InChIKey | GXHDACWBRCEXFC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.61 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |