C20H38N4O2S — CID 130208780
6,8,9-tritert-butyl-N-methyl-1,3,4,8-tetrahydropyrazino[1,2-c]pyrimidine-2-sulfonamide (PubChem CID 130208780) has the molecular formula C20H38N4O2S and a molecular weight of 398.62 g/mol. Its IUPAC name is 6,8,9-tritert-butyl-N-methyl-1,3,4,8-tetrahydropyrazino[1,2-c]pyrimidine-2-sulfonamide.
| Compound Name | 6,8,9-tritert-butyl-N-methyl-1,3,4,8-tetrahydropyrazino[1,2-c]pyrimidine-2-sulfonamide |
|---|---|
| PubChem CID | 130208780 |
| Molecular Formula | C20H38N4O2S |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | 6,8,9-tritert-butyl-N-methyl-1,3,4,8-tetrahydropyrazino[1,2-c]pyrimidine-2-sulfonamide |
| SMILES | CNS(=O)(=O)N1CCN2C(C(C)(C)C)=NC(C(C)(C)C)C(C(C)(C)C)=C2C1 |
| InChI | InChI=1S/C20H38N4O2S/c1-18(2,3)15-14-13-23(27(25,26)21-10)11-12-24(14)17(20(7,8)9)22-16(15)19(4,5)6/h16,21H,11-13H2,1-10H3 |
| InChIKey | XXEPCRWQPROMSK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |