C20H37N3O2S3 — CID 130219019
N-[[1,3-ditert-butyl-4-[2-(disulfanyl)propan-2-yl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methyl]methanesulfonamide (PubChem CID 130219019) has the molecular formula C20H37N3O2S3 and a molecular weight of 447.74 g/mol. Its IUPAC name is N-[[1,3-ditert-butyl-4-[2-(disulfanyl)propan-2-yl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methyl]methanesulfonamide.
| Compound Name | N-[[1,3-ditert-butyl-4-[2-(disulfanyl)propan-2-yl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 130219019 |
| Molecular Formula | C20H37N3O2S3 |
| Molecular Weight | 447.74 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | N-[[1,3-ditert-butyl-4-[2-(disulfanyl)propan-2-yl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methyl]methanesulfonamide |
| SMILES | CC(C)(C)C1=NC(C(C)(C)C)C(C(C)(C)SS)=C2CC(CNS(C)(=O)=O)CN12 |
| InChI | InChI=1S/C20H37N3O2S3/c1-18(2,3)16-15(20(7,8)27-26)14-10-13(11-21-28(9,24)25)12-23(14)17(22-16)19(4,5)6/h13,16,21,26H,10-12H2,1-9H3 |
| InChIKey | VYQFOPDVQUQHQE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.74 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|