C23H41N3O3S — CID 130208736
3-hydroxy-N-(1,3,4-tritert-butyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl)cyclobutane-1-sulfonamide (PubChem CID 130208736) has the molecular formula C23H41N3O3S and a molecular weight of 439.67 g/mol. Its IUPAC name is 3-hydroxy-N-(1,3,4-tritert-butyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl)cyclobutane-1-sulfonamide.
| Compound Name | 3-hydroxy-N-(1,3,4-tritert-butyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl)cyclobutane-1-sulfonamide |
|---|---|
| PubChem CID | 130208736 |
| Molecular Formula | C23H41N3O3S |
| Molecular Weight | 439.67 g/mol |
| Exact Mass | 439.29 |
| IUPAC Name | 3-hydroxy-N-(1,3,4-tritert-butyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl)cyclobutane-1-sulfonamide |
| SMILES | CC(C)(C)C1=NC(C(C)(C)C)C(C(C)(C)C)=C2CC(NS(=O)(=O)C3CC(O)C3)CN12 |
| InChI | InChI=1S/C23H41N3O3S/c1-21(2,3)18-17-10-14(25-30(28,29)16-11-15(27)12-16)13-26(17)20(23(7,8)9)24-19(18)22(4,5)6/h14-16,19,25,27H,10-13H2,1-9H3 |
| InChIKey | SSNGTMKMJVYCSL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.67 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |