C18H29F2N3O2S — CID 130218807
N-[(3S,6S)-4-tert-butyl-1-ethyl-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]-3,3-difluorocyclobutane-1-sulfonamide (PubChem CID 130218807) has the molecular formula C18H29F2N3O2S and a molecular weight of 389.51 g/mol. Its IUPAC name is N-[(3S,6S)-4-tert-butyl-1-ethyl-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]-3,3-difluorocyclobutane-1-sulfonamide.
| Compound Name | N-[(3S,6S)-4-tert-butyl-1-ethyl-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]-3,3-difluorocyclobutane-1-sulfonamide |
|---|---|
| PubChem CID | 130218807 |
| Molecular Formula | C18H29F2N3O2S |
| Molecular Weight | 389.51 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | N-[(3S,6S)-4-tert-butyl-1-ethyl-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]-3,3-difluorocyclobutane-1-sulfonamide |
| SMILES | CCC1=N[C@@H](C)C(C(C)(C)C)=C2C[C@H](NS(=O)(=O)C3CC(F)(F)C3)CN12 |
| InChI | InChI=1S/C18H29F2N3O2S/c1-6-15-21-11(2)16(17(3,4)5)14-7-12(10-23(14)15)22-26(24,25)13-8-18(19,20)9-13/h11-13,22H,6-10H2,1-5H3/t11-,12-/m0/s1 |
| InChIKey | XBUGYRNRSXLWJW-RYUDHWBXSA-N |
| XLogP | 3.29 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |