C24H42N4O3S2 — CID 130218625
1-acetyl-N-[3,4-ditert-butyl-1-(1-ethylsulfanylethyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]azetidine-3-sulfonamide (PubChem CID 130218625) has the molecular formula C24H42N4O3S2 and a molecular weight of 498.76 g/mol. Its IUPAC name is 1-acetyl-N-[3,4-ditert-butyl-1-(1-ethylsulfanylethyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]azetidine-3-sulfonamide.
| Compound Name | 1-acetyl-N-[3,4-ditert-butyl-1-(1-ethylsulfanylethyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]azetidine-3-sulfonamide |
|---|---|
| PubChem CID | 130218625 |
| Molecular Formula | C24H42N4O3S2 |
| Molecular Weight | 498.76 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | 1-acetyl-N-[3,4-ditert-butyl-1-(1-ethylsulfanylethyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]azetidine-3-sulfonamide |
| SMILES | CCSC(C)C1=NC(C(C)(C)C)C(C(C)(C)C)=C2CC(NS(=O)(=O)C3CN(C(C)=O)C3)CN12 |
| InChI | InChI=1S/C24H42N4O3S2/c1-10-32-15(2)22-25-21(24(7,8)9)20(23(4,5)6)19-11-17(12-28(19)22)26-33(30,31)18-13-27(14-18)16(3)29/h15,17-18,21,26H,10-14H2,1-9H3 |
| InChIKey | NDMKXZFYOKLHNB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.76 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |