C21H40N4O2S — CID 130208901
(3S,6S)-1,4-ditert-butyl-6-[[butyl(methyl)sulfamoyl]amino]-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine (PubChem CID 130208901) has the molecular formula C21H40N4O2S and a molecular weight of 412.64 g/mol. Its IUPAC name is (3S,6S)-1,4-ditert-butyl-6-[[butyl(methyl)sulfamoyl]amino]-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine.
| Compound Name | (3S,6S)-1,4-ditert-butyl-6-[[butyl(methyl)sulfamoyl]amino]-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine |
|---|---|
| PubChem CID | 130208901 |
| Molecular Formula | C21H40N4O2S |
| Molecular Weight | 412.64 g/mol |
| Exact Mass | 412.29 |
| IUPAC Name | (3S,6S)-1,4-ditert-butyl-6-[[butyl(methyl)sulfamoyl]amino]-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine |
| SMILES | CCCCN(C)S(=O)(=O)N[C@H]1CC2=C(C(C)(C)C)[C@H](C)N=C(C(C)(C)C)N2C1 |
| InChI | InChI=1S/C21H40N4O2S/c1-10-11-12-24(9)28(26,27)23-16-13-17-18(20(3,4)5)15(2)22-19(21(6,7)8)25(17)14-16/h15-16,23H,10-14H2,1-9H3/t15-,16-/m0/s1 |
| InChIKey | DSDBSIZKIVBGPS-HOTGVXAUSA-N |
| XLogP | 3.77 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.64 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |