C20H38N4O2S — CID 130208893
(3S,6S)-1,4-ditert-butyl-N-(tert-butylsulfamoyl)-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-amine (PubChem CID 130208893) has the molecular formula C20H38N4O2S and a molecular weight of 398.62 g/mol. Its IUPAC name is (3S,6S)-1,4-ditert-butyl-N-(tert-butylsulfamoyl)-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-amine.
| Compound Name | (3S,6S)-1,4-ditert-butyl-N-(tert-butylsulfamoyl)-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-amine |
|---|---|
| PubChem CID | 130208893 |
| Molecular Formula | C20H38N4O2S |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | (3S,6S)-1,4-ditert-butyl-N-(tert-butylsulfamoyl)-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-amine |
| SMILES | C[C@@H]1N=C(C(C)(C)C)N2C[C@@H](NS(=O)(=O)NC(C)(C)C)CC2=C1C(C)(C)C |
| InChI | InChI=1S/C20H38N4O2S/c1-13-16(18(2,3)4)15-11-14(22-27(25,26)23-20(8,9)10)12-24(15)17(21-13)19(5,6)7/h13-14,22-23H,11-12H2,1-10H3/t13-,14-/m0/s1 |
| InChIKey | BUZZAJIFSJEIIK-KBPBESRZSA-N |
| XLogP | 3.43 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |